C24H36N4O2 — CID 98548254
N-[4-(azepan-1-yl)phenyl]-2-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoylamino]acetamide (PubChem CID 98548254) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-2-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoylamino]acetamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-2-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoylamino]acetamide |
|---|---|
| PubChem CID | 98548254 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-2-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoylamino]acetamide |
| SMILES | C[C@@H](NC(=O)NCC(=O)Nc1ccc(N2CCCCCC2)cc1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C24H36N4O2/c1-17(22-15-18-6-7-19(22)14-18)26-24(30)25-16-23(29)27-20-8-10-21(11-9-20)28-12-4-2-3-5-13-28/h8-11,17-19,22H,2-7,12-16H2,1H3,(H,27,29)(H2,25,26,30)/t17-,18+,19+,22+/m1/s1 |
| InChIKey | ROPPTWFKHJLTBG-GHDARCQNSA-N |
| XLogP | 4.13 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|