C22H27NO4 — CID 98552148
(1R,2R,4S,5R)-1,5-bis(hydroxymethyl)-7-methyl-2,4-diphenyl-3-oxa-7-azabicyclo[3.3.1]nonan-9-ol (PubChem CID 98552148) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (1R,2R,4S,5R)-1,5-bis(hydroxymethyl)-7-methyl-2,4-diphenyl-3-oxa-7-azabicyclo[3.3.1]nonan-9-ol.
| Compound Name | (1R,2R,4S,5R)-1,5-bis(hydroxymethyl)-7-methyl-2,4-diphenyl-3-oxa-7-azabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 98552148 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (1R,2R,4S,5R)-1,5-bis(hydroxymethyl)-7-methyl-2,4-diphenyl-3-oxa-7-azabicyclo[3.3.1]nonan-9-ol |
| SMILES | CN1C[C@@]2(CO)C(O)[C@](CO)(C1)[C@H](c1ccccc1)O[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C22H27NO4/c1-23-12-21(14-24)18(16-8-4-2-5-9-16)27-19(17-10-6-3-7-11-17)22(13-23,15-25)20(21)26/h2-11,18-20,24-26H,12-15H2,1H3/t18-,19+,20?,21-,22-/m0/s1 |
| InChIKey | HGOIZBXGKQHHEE-OACCOTFLSA-N |
| XLogP | 1.76 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |