C15H20O4 — CID 98553551
methyl 5-[(3aS,7aS)-3-hydroxy-1-oxo-3a,4,7,7a-tetrahydroinden-5-yl]pentanoate (PubChem CID 98553551) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 5-[(3aS,7aS)-3-hydroxy-1-oxo-3a,4,7,7a-tetrahydroinden-5-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,7aS)-3-hydroxy-1-oxo-3a,4,7,7a-tetrahydroinden-5-yl]pentanoate |
|---|---|
| PubChem CID | 98553551 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | methyl 5-[(3aS,7aS)-3-hydroxy-1-oxo-3a,4,7,7a-tetrahydroinden-5-yl]pentanoate |
| SMILES | COC(=O)CCCCC1=CC[C@@H]2C(=O)C=C(O)[C@H]2C1 |
| InChI | InChI=1S/C15H20O4/c1-19-15(18)5-3-2-4-10-6-7-11-12(8-10)14(17)9-13(11)16/h6,9,11-12,17H,2-5,7-8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | YIMKERDWFDQPRN-RYUDHWBXSA-N |
| XLogP | 2.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|