C11H13NO — CID 98554059
(1R,6R)-8-methoxy-3-methyl-7-azabicyclo[4.2.2]deca-2,4,7,9-tetraene (PubChem CID 98554059) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (1R,6R)-8-methoxy-3-methyl-7-azabicyclo[4.2.2]deca-2,4,7,9-tetraene.
| Compound Name | (1R,6R)-8-methoxy-3-methyl-7-azabicyclo[4.2.2]deca-2,4,7,9-tetraene |
|---|---|
| PubChem CID | 98554059 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (1R,6R)-8-methoxy-3-methyl-7-azabicyclo[4.2.2]deca-2,4,7,9-tetraene |
| SMILES | COC1=N[C@H]2C=CC(C)=C[C@H]1C=C2 |
| InChI | InChI=1S/C11H13NO/c1-8-3-5-10-6-4-9(7-8)11(12-10)13-2/h3-7,9-10H,1-2H3/t9-,10+/m1/s1 |
| InChIKey | MHHLDORIHKKQQA-ZJUUUORDSA-N |
| XLogP | 2.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|