C19H19N5OS — CID 98554609
(2Z,3S)-2-(carbamothioylhydrazinylidene)-3-cyano-N-(2,5-dimethylphenyl)-3-phenylpropanamide (PubChem CID 98554609) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is (2Z,3S)-2-(carbamothioylhydrazinylidene)-3-cyano-N-(2,5-dimethylphenyl)-3-phenylpropanamide.
| Compound Name | (2Z,3S)-2-(carbamothioylhydrazinylidene)-3-cyano-N-(2,5-dimethylphenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 98554609 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (2Z,3S)-2-(carbamothioylhydrazinylidene)-3-cyano-N-(2,5-dimethylphenyl)-3-phenylpropanamide |
| SMILES | Cc1ccc(C)c(NC(=O)/C(=N\NC(N)=S)[C@@H](C#N)c2ccccc2)c1 |
| InChI | InChI=1S/C19H19N5OS/c1-12-8-9-13(2)16(10-12)22-18(25)17(23-24-19(21)26)15(11-20)14-6-4-3-5-7-14/h3-10,15H,1-2H3,(H,22,25)(H3,21,24,26)/b23-17-/t15-/m0/s1 |
| InChIKey | TWLKLEPGFUUZIZ-ADSWHHSESA-N |
| XLogP | 2.74 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|