C13H17N3O2 — CID 98557710
(1S,2S,3R,6R,7S,8S)-11-methyl-9,11,13-triazapentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione (PubChem CID 98557710) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (1S,2S,3R,6R,7S,8S)-11-methyl-9,11,13-triazapentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione.
| Compound Name | (1S,2S,3R,6R,7S,8S)-11-methyl-9,11,13-triazapentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione |
|---|---|
| PubChem CID | 98557710 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (1S,2S,3R,6R,7S,8S)-11-methyl-9,11,13-triazapentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@H]1C[C@H]2[C@H]2[C@@H]3CC[C@H](C3)[C@@H]21 |
| InChI | InChI=1S/C13H17N3O2/c1-14-12(17)15-8-5-9(16(15)13(14)18)11-7-3-2-6(4-7)10(8)11/h6-11H,2-5H2,1H3/t6-,7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | YTEFTNDKTSPOFJ-VFZPANTDSA-N |
| XLogP | 0.51 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|