C24H28O5 — CID 98557867
ethyl (2E)-2-[(2S,3R,6S,7R,9E,10S,11R,12R,14S,15R,17S)-9-(2-ethoxy-2-oxoethylidene)-13-oxaheptacyclo[8.6.1.02,6.03,15.07,17.011,16.012,14]heptadecan-4-ylidene]acetate (PubChem CID 98557867) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is ethyl (2E)-2-[(2S,3R,6S,7R,9E,10S,11R,12R,14S,15R,17S)-9-(2-ethoxy-2-oxoethylidene)-13-oxaheptacyclo[8.6.1.02,6.03,15.07,17.011,16.012,14]heptadecan-4-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(2S,3R,6S,7R,9E,10S,11R,12R,14S,15R,17S)-9-(2-ethoxy-2-oxoethylidene)-13-oxaheptacyclo[8.6.1.02,6.03,15.07,17.011,16.012,14]heptadecan-4-ylidene]acetate |
|---|---|
| PubChem CID | 98557867 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | ethyl (2E)-2-[(2S,3R,6S,7R,9E,10S,11R,12R,14S,15R,17S)-9-(2-ethoxy-2-oxoethylidene)-13-oxaheptacyclo[8.6.1.02,6.03,15.07,17.011,16.012,14]heptadecan-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C[C@H]2[C@H]3C/C(=C\C(=O)OCC)[C@H]4[C@@H]3C3C5[C@@H]([C@@H]6O[C@@H]6[C@H]54)[C@H]1[C@H]32 |
| InChI | InChI=1S/C24H28O5/c1-3-27-13(25)7-9-5-11-12-6-10(8-14(26)28-4-2)16-18(12)19-17(11)15(9)21-20(19)22(16)24-23(21)29-24/h7-8,11-12,15-24H,3-6H2,1-2H3/b9-7+,10-8+/t11-,12+,15+,16-,17-,18-,19?,20?,21+,22+,23-,24+/m1/s1 |
| InChIKey | PQZHGKNYSHTADS-LCXNEOGQSA-N |
| XLogP | 2.76 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|