C22H28N4O4S3 — CID 98558888
(2R,5R,6S)-3,3-dimethyl-7-oxo-6-[[(2R)-2-phenyl-2-(5-propan-2-yl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 98558888) has the molecular formula C22H28N4O4S3 and a molecular weight of 508.69 g/mol. Its IUPAC name is (2R,5R,6S)-3,3-dimethyl-7-oxo-6-[[(2R)-2-phenyl-2-(5-propan-2-yl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,5R,6S)-3,3-dimethyl-7-oxo-6-[[(2R)-2-phenyl-2-(5-propan-2-yl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 98558888 |
| Molecular Formula | C22H28N4O4S3 |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | (2R,5R,6S)-3,3-dimethyl-7-oxo-6-[[(2R)-2-phenyl-2-(5-propan-2-yl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(C)N1CN([C@@H](C(=O)N[C@H]2C(=O)N3[C@@H]2SC(C)(C)[C@H]3C(=O)O)c2ccccc2)CSC1=S |
| InChI | InChI=1S/C22H28N4O4S3/c1-12(2)25-10-24(11-32-21(25)31)15(13-8-6-5-7-9-13)17(27)23-14-18(28)26-16(20(29)30)22(3,4)33-19(14)26/h5-9,12,14-16,19H,10-11H2,1-4H3,(H,23,27)(H,29,30)/t14-,15+,16+,19+/m0/s1 |
| InChIKey | MDXYRYAVESSDPS-WFXMFSGNSA-N |
| XLogP | 2.32 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|