C22H28N4O5S3 — CID 98558894
(2R,5R,6S)-6-[[(2S)-2-(4-hydroxyphenyl)-2-(5-propan-2-yl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 98558894) has the molecular formula C22H28N4O5S3 and a molecular weight of 524.69 g/mol. Its IUPAC name is (2R,5R,6S)-6-[[(2S)-2-(4-hydroxyphenyl)-2-(5-propan-2-yl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,5R,6S)-6-[[(2S)-2-(4-hydroxyphenyl)-2-(5-propan-2-yl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 98558894 |
| Molecular Formula | C22H28N4O5S3 |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | (2R,5R,6S)-6-[[(2S)-2-(4-hydroxyphenyl)-2-(5-propan-2-yl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(C)N1CN([C@H](C(=O)N[C@H]2C(=O)N3[C@@H]2SC(C)(C)[C@H]3C(=O)O)c2ccc(O)cc2)CSC1=S |
| InChI | InChI=1S/C22H28N4O5S3/c1-11(2)25-9-24(10-33-21(25)32)15(12-5-7-13(27)8-6-12)17(28)23-14-18(29)26-16(20(30)31)22(3,4)34-19(14)26/h5-8,11,14-16,19,27H,9-10H2,1-4H3,(H,23,28)(H,30,31)/t14-,15-,16+,19+/m0/s1 |
| InChIKey | HLOVLXOMEHUUPK-YIOZNXECSA-N |
| XLogP | 2.02 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|