C22H36N2O — CID 98575050
(1R,2S,5R,6R,9R,10R,19R)-1,5,6-trimethyl-14,18-diazapentacyclo[11.8.0.02,10.05,9.014,19]henicos-12-en-6-ol (PubChem CID 98575050) has the molecular formula C22H36N2O and a molecular weight of 344.54 g/mol. Its IUPAC name is (1R,2S,5R,6R,9R,10R,19R)-1,5,6-trimethyl-14,18-diazapentacyclo[11.8.0.02,10.05,9.014,19]henicos-12-en-6-ol.
| Compound Name | (1R,2S,5R,6R,9R,10R,19R)-1,5,6-trimethyl-14,18-diazapentacyclo[11.8.0.02,10.05,9.014,19]henicos-12-en-6-ol |
|---|---|
| PubChem CID | 98575050 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | (1R,2S,5R,6R,9R,10R,19R)-1,5,6-trimethyl-14,18-diazapentacyclo[11.8.0.02,10.05,9.014,19]henicos-12-en-6-ol |
| SMILES | C[C@]12CC[C@@H]3NCCCN3C1=CC[C@H]1[C@H]3CC[C@@](C)(O)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C22H36N2O/c1-20-10-9-19-23-13-4-14-24(19)18(20)6-5-15-16(20)7-11-21(2)17(15)8-12-22(21,3)25/h6,15-17,19,23,25H,4-5,7-14H2,1-3H3/t15-,16+,17-,19-,20-,21-,22-/m1/s1 |
| InChIKey | VTUJCRYRYIZIRS-DNAOUPSLSA-N |
| XLogP | 3.89 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |