C35H35N5O2 — CID 98582790
4-[[1-[(4-benzylpiperazin-1-yl)methyl]-2-oxoindol-3-ylidene]amino]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 98582790) has the molecular formula C35H35N5O2 and a molecular weight of 557.70 g/mol. Its IUPAC name is 4-[[1-[(4-benzylpiperazin-1-yl)methyl]-2-oxoindol-3-ylidene]amino]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 4-[[1-[(4-benzylpiperazin-1-yl)methyl]-2-oxoindol-3-ylidene]amino]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 98582790 |
| Molecular Formula | C35H35N5O2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 4-[[1-[(4-benzylpiperazin-1-yl)methyl]-2-oxoindol-3-ylidene]amino]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/N=C2\C(=O)N(CN3CCN(Cc4ccccc4)CC3)c3ccccc32)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H35N5O2/c1-26(28-12-6-3-7-13-28)36-34(41)29-16-18-30(19-17-29)37-33-31-14-8-9-15-32(31)40(35(33)42)25-39-22-20-38(21-23-39)24-27-10-4-2-5-11-27/h2-19,26H,20-25H2,1H3,(H,36,41)/b37-33-/t26-/m1/s1 |
| InChIKey | NSXAIBDSVMYMTA-WCOSCEHPSA-N |
| XLogP | 5.42 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|