C23H28N6O3S — CID 98598828
N-[4-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 98598828) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-[4-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[4-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 98598828 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-[4-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(C(=O)Nc3ccc(S(=O)(=O)N[C@H](C)[C@@H]4C[C@H]5CC[C@H]4C5)cc3)nc2n1 |
| InChI | InChI=1S/C23H28N6O3S/c1-13-10-14(2)29-23(24-13)26-21(27-29)22(30)25-18-6-8-19(9-7-18)33(31,32)28-15(3)20-12-16-4-5-17(20)11-16/h6-10,15-17,20,28H,4-5,11-12H2,1-3H3,(H,25,30)/t15-,16+,17+,20+/m1/s1 |
| InChIKey | UMCXHDCWNJNXML-YLAKUSLOSA-N |
| XLogP | 3.10 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |