C34H43N3O — CID 98634851
N-cyclohexyl-N-[[(3S,4R)-1-[[4-(dimethylamino)phenyl]methyl]-4-(2-methylphenyl)pyrrolidin-3-yl]methyl]benzamide (PubChem CID 98634851) has the molecular formula C34H43N3O and a molecular weight of 509.74 g/mol. Its IUPAC name is N-cyclohexyl-N-[[(3S,4R)-1-[[4-(dimethylamino)phenyl]methyl]-4-(2-methylphenyl)pyrrolidin-3-yl]methyl]benzamide.
| Compound Name | N-cyclohexyl-N-[[(3S,4R)-1-[[4-(dimethylamino)phenyl]methyl]-4-(2-methylphenyl)pyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 98634851 |
| Molecular Formula | C34H43N3O |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | N-cyclohexyl-N-[[(3S,4R)-1-[[4-(dimethylamino)phenyl]methyl]-4-(2-methylphenyl)pyrrolidin-3-yl]methyl]benzamide |
| SMILES | Cc1ccccc1[C@@H]1CN(Cc2ccc(N(C)C)cc2)C[C@H]1CN(C(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C34H43N3O/c1-26-12-10-11-17-32(26)33-25-36(22-27-18-20-30(21-19-27)35(2)3)23-29(33)24-37(31-15-8-5-9-16-31)34(38)28-13-6-4-7-14-28/h4,6-7,10-14,17-21,29,31,33H,5,8-9,15-16,22-25H2,1-3H3/t29-,33+/m0/s1 |
| InChIKey | QYHZWLNQVIHIEP-RYCFQHDISA-N |
| XLogP | 6.75 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|