C31H36N2O2 — CID 92992533
N-cyclohexyl-N-[[(3R,4S)-1-[(2-hydroxyphenyl)methyl]-4-phenylpyrrolidin-3-yl]methyl]benzamide (PubChem CID 92992533) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-cyclohexyl-N-[[(3R,4S)-1-[(2-hydroxyphenyl)methyl]-4-phenylpyrrolidin-3-yl]methyl]benzamide.
| Compound Name | N-cyclohexyl-N-[[(3R,4S)-1-[(2-hydroxyphenyl)methyl]-4-phenylpyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 92992533 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | N-cyclohexyl-N-[[(3R,4S)-1-[(2-hydroxyphenyl)methyl]-4-phenylpyrrolidin-3-yl]methyl]benzamide |
| SMILES | O=C(c1ccccc1)N(C[C@H]1CN(Cc2ccccc2O)C[C@@H]1c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C31H36N2O2/c34-30-19-11-10-16-26(30)20-32-21-27(29(23-32)24-12-4-1-5-13-24)22-33(28-17-8-3-9-18-28)31(35)25-14-6-2-7-15-25/h1-2,4-7,10-16,19,27-29,34H,3,8-9,17-18,20-23H2/t27-,29-/m1/s1 |
| InChIKey | GPVFGARUZLYJPS-XRKRLSELSA-N |
| XLogP | 6.08 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|