C28H37N3O3 — CID 129423187
N-cyclohexyl-2-methyl-N-[[(3S,4R)-1-[(2-nitrophenyl)methyl]-4-phenylpyrrolidin-3-yl]methyl]propanamide (PubChem CID 129423187) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-cyclohexyl-2-methyl-N-[[(3S,4R)-1-[(2-nitrophenyl)methyl]-4-phenylpyrrolidin-3-yl]methyl]propanamide.
| Compound Name | N-cyclohexyl-2-methyl-N-[[(3S,4R)-1-[(2-nitrophenyl)methyl]-4-phenylpyrrolidin-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 129423187 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-cyclohexyl-2-methyl-N-[[(3S,4R)-1-[(2-nitrophenyl)methyl]-4-phenylpyrrolidin-3-yl]methyl]propanamide |
| SMILES | CC(C)C(=O)N(C[C@@H]1CN(Cc2ccccc2[N+](=O)[O-])C[C@H]1c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C28H37N3O3/c1-21(2)28(32)30(25-14-7-4-8-15-25)19-24-18-29(20-26(24)22-11-5-3-6-12-22)17-23-13-9-10-16-27(23)31(33)34/h3,5-6,9-13,16,21,24-26H,4,7-8,14-15,17-20H2,1-2H3/t24-,26-/m0/s1 |
| InChIKey | RMEJFOBXHWKKLX-AHWVRZQESA-N |
| XLogP | 5.63 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|