C29H32FN3O3 — CID 92992315
4-fluoro-N-[[(3R,4R)-4-(2-methylphenyl)-1-[(2-nitrophenyl)methyl]pyrrolidin-3-yl]methyl]-N-propan-2-ylbenzamide (PubChem CID 92992315) has the molecular formula C29H32FN3O3 and a molecular weight of 489.59 g/mol. Its IUPAC name is 4-fluoro-N-[[(3R,4R)-4-(2-methylphenyl)-1-[(2-nitrophenyl)methyl]pyrrolidin-3-yl]methyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-fluoro-N-[[(3R,4R)-4-(2-methylphenyl)-1-[(2-nitrophenyl)methyl]pyrrolidin-3-yl]methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 92992315 |
| Molecular Formula | C29H32FN3O3 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 4-fluoro-N-[[(3R,4R)-4-(2-methylphenyl)-1-[(2-nitrophenyl)methyl]pyrrolidin-3-yl]methyl]-N-propan-2-ylbenzamide |
| SMILES | Cc1ccccc1[C@@H]1CN(Cc2ccccc2[N+](=O)[O-])C[C@@H]1CN(C(=O)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C29H32FN3O3/c1-20(2)32(29(34)22-12-14-25(30)15-13-22)18-24-17-31(16-23-9-5-7-11-28(23)33(35)36)19-27(24)26-10-6-4-8-21(26)3/h4-15,20,24,27H,16-19H2,1-3H3/t24-,27-/m1/s1 |
| InChIKey | ZAJFJTRMBWJPSW-SHQCIBLASA-N |
| XLogP | 5.81 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|