C14H22N4O2S — CID 98659160
2-amino-6-[2-(2-methylpropylamino)-2-oxoethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 98659160) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-amino-6-[2-(2-methylpropylamino)-2-oxoethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 2-amino-6-[2-(2-methylpropylamino)-2-oxoethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 98659160 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-amino-6-[2-(2-methylpropylamino)-2-oxoethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CC(C)CNC(=O)CN1CCc2c(sc(N)c2C(N)=O)C1 |
| InChI | InChI=1S/C14H22N4O2S/c1-8(2)5-17-11(19)7-18-4-3-9-10(6-18)21-14(16)12(9)13(15)20/h8H,3-7,16H2,1-2H3,(H2,15,20)(H,17,19) |
| InChIKey | KXILAASOXFZKBY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|