C26H31N3O3 — CID 98724103
(E)-3-(3-methoxy-4-propan-2-yloxyphenyl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]prop-2-enamide (PubChem CID 98724103) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 98724103 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCCc2cn(-c3ccccc3)nc2C)ccc1OC(C)C |
| InChI | InChI=1S/C26H31N3O3/c1-19(2)32-24-14-12-21(17-25(24)31-4)13-15-26(30)27-16-8-9-22-18-29(28-20(22)3)23-10-6-5-7-11-23/h5-7,10-15,17-19H,8-9,16H2,1-4H3,(H,27,30)/b15-13+ |
| InChIKey | HQFVLYXLFOKFFC-FYWRMAATSA-N |
| XLogP | 4.74 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|