C24H30N4O4S — CID 98727506
5-[[1-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-4,5-dimethylimidazol-2-yl]sulfonylmethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 98727506) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is 5-[[1-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-4,5-dimethylimidazol-2-yl]sulfonylmethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[1-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-4,5-dimethylimidazol-2-yl]sulfonylmethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 98727506 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 5-[[1-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-4,5-dimethylimidazol-2-yl]sulfonylmethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(CS(=O)(=O)c3nc(C)c(C)n3[C@H](C)[C@@H]3C[C@H]4CC[C@H]3C4)n2)cc1 |
| InChI | InChI=1S/C24H30N4O4S/c1-14-15(2)28(16(3)21-12-17-5-6-19(21)11-17)24(25-14)33(29,30)13-22-26-23(27-32-22)18-7-9-20(31-4)10-8-18/h7-10,16-17,19,21H,5-6,11-13H2,1-4H3/t16-,17+,19+,21+/m1/s1 |
| InChIKey | LZFIWPSLGFMDGS-IGGJEDBVSA-N |
| XLogP | 4.53 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |