C17H24N4OS2 — CID 98749497
(6S)-6-methyl-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 98749497) has the molecular formula C17H24N4OS2 and a molecular weight of 364.54 g/mol. Its IUPAC name is (6S)-6-methyl-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-methyl-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 98749497 |
| Molecular Formula | C17H24N4OS2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (6S)-6-methyl-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)n1c(CCNC(=O)c2csc3c2CC[C@H](C)C3)n[nH]c1=S |
| InChI | InChI=1S/C17H24N4OS2/c1-10(2)21-15(19-20-17(21)23)6-7-18-16(22)13-9-24-14-8-11(3)4-5-12(13)14/h9-11H,4-8H2,1-3H3,(H,18,22)(H,20,23)/t11-/m0/s1 |
| InChIKey | WALMSYVGYKLCLR-NSHDSACASA-N |
| XLogP | 3.68 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|