C16H19N3OS — CID 98751355
(2S,3aS,7aS)-1-(1,3-benzothiazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 98751355) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-(1,3-benzothiazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-(1,3-benzothiazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 98751355 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2S,3aS,7aS)-1-(1,3-benzothiazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H19N3OS/c17-15(20)13-9-10-5-1-3-7-12(10)19(13)16-18-11-6-2-4-8-14(11)21-16/h2,4,6,8,10,12-13H,1,3,5,7,9H2,(H2,17,20)/t10-,12-,13-/m0/s1 |
| InChIKey | VRVHZBDQJZZYHE-DRZSPHRISA-N |
| XLogP | 2.92 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |