C14H15BrINO — CID 98753327
(1S,2R,4S)-N-(5-bromo-2-iodophenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98753327) has the molecular formula C14H15BrINO and a molecular weight of 420.09 g/mol. Its IUPAC name is (1S,2R,4S)-N-(5-bromo-2-iodophenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,4S)-N-(5-bromo-2-iodophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98753327 |
| Molecular Formula | C14H15BrINO |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | (1S,2R,4S)-N-(5-bromo-2-iodophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1I)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H15BrINO/c15-10-3-4-12(16)13(7-10)17-14(18)11-6-8-1-2-9(11)5-8/h3-4,7-9,11H,1-2,5-6H2,(H,17,18)/t8-,9-,11+/m0/s1 |
| InChIKey | XAUIUHANTJPYFV-ATZCPNFKSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|