C17H29N3O2S — CID 98767316
2-[(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]piperazin-1-yl]-N-(2-thiophen-3-ylethyl)acetamide (PubChem CID 98767316) has the molecular formula C17H29N3O2S and a molecular weight of 339.51 g/mol. Its IUPAC name is 2-[(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]piperazin-1-yl]-N-(2-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-[(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]piperazin-1-yl]-N-(2-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 98767316 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-[(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]piperazin-1-yl]-N-(2-thiophen-3-ylethyl)acetamide |
| SMILES | CC[C@@H]1CN(CC(=O)NCCc2ccsc2)CCN1C[C@H](C)O |
| InChI | InChI=1S/C17H29N3O2S/c1-3-16-11-19(7-8-20(16)10-14(2)21)12-17(22)18-6-4-15-5-9-23-13-15/h5,9,13-14,16,21H,3-4,6-8,10-12H2,1-2H3,(H,18,22)/t14-,16+/m0/s1 |
| InChIKey | MFESKHGLHODKCU-GOEBONIOSA-N |
| XLogP | 1.18 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |