C22H29N3O2 — CID 98848186
(3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]-N-(4-phenylphenyl)piperazine-1-carboxamide (PubChem CID 98848186) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is (3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]-N-(4-phenylphenyl)piperazine-1-carboxamide.
| Compound Name | (3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]-N-(4-phenylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 98848186 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (3R)-3-ethyl-4-[(2S)-2-hydroxypropyl]-N-(4-phenylphenyl)piperazine-1-carboxamide |
| SMILES | CC[C@@H]1CN(C(=O)Nc2ccc(-c3ccccc3)cc2)CCN1C[C@H](C)O |
| InChI | InChI=1S/C22H29N3O2/c1-3-21-16-25(14-13-24(21)15-17(2)26)22(27)23-20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-12,17,21,26H,3,13-16H2,1-2H3,(H,23,27)/t17-,21+/m0/s1 |
| InChIKey | UCHGZMFBWCEKSC-LAUBAEHRSA-N |
| XLogP | 3.66 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |