C18H23N3O3 — CID 98767916
(5S)-7-[(2R,3S)-3-methyl-2-phenylpentanoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 98767916) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (5S)-7-[(2R,3S)-3-methyl-2-phenylpentanoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S)-7-[(2R,3S)-3-methyl-2-phenylpentanoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 98767916 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (5S)-7-[(2R,3S)-3-methyl-2-phenylpentanoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC[C@H](C)[C@@H](C(=O)N1CC[C@@]2(C1)NC(=O)NC2=O)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-12(2)14(13-7-5-4-6-8-13)15(22)21-10-9-18(11-21)16(23)19-17(24)20-18/h4-8,12,14H,3,9-11H2,1-2H3,(H2,19,20,23,24)/t12-,14+,18-/m0/s1 |
| InChIKey | ZFHXJNOYDTUQIG-WRSAYESZSA-N |
| XLogP | 1.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|