C15H25N3O — CID 98770541
2-[(2R)-1-propan-2-yl-4-(pyridin-2-ylmethyl)piperazin-2-yl]ethanol (PubChem CID 98770541) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-[(2R)-1-propan-2-yl-4-(pyridin-2-ylmethyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-1-propan-2-yl-4-(pyridin-2-ylmethyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 98770541 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2-[(2R)-1-propan-2-yl-4-(pyridin-2-ylmethyl)piperazin-2-yl]ethanol |
| SMILES | CC(C)N1CCN(Cc2ccccn2)C[C@H]1CCO |
| InChI | InChI=1S/C15H25N3O/c1-13(2)18-9-8-17(12-15(18)6-10-19)11-14-5-3-4-7-16-14/h3-5,7,13,15,19H,6,8-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | DJAXNHRPMQEPME-OAHLLOKOSA-N |
| XLogP | 1.36 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |