C20H25N3O2 — CID 98775527
1-[(3R,4R)-1-benzyl-4-(hydroxymethyl)piperidin-3-yl]-3-phenylurea (PubChem CID 98775527) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[(3R,4R)-1-benzyl-4-(hydroxymethyl)piperidin-3-yl]-3-phenylurea.
| Compound Name | 1-[(3R,4R)-1-benzyl-4-(hydroxymethyl)piperidin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 98775527 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-[(3R,4R)-1-benzyl-4-(hydroxymethyl)piperidin-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@H]1CN(Cc2ccccc2)CC[C@H]1CO |
| InChI | InChI=1S/C20H25N3O2/c24-15-17-11-12-23(13-16-7-3-1-4-8-16)14-19(17)22-20(25)21-18-9-5-2-6-10-18/h1-10,17,19,24H,11-15H2,(H2,21,22,25)/t17-,19-/m0/s1 |
| InChIKey | DSHSWYAWTIEPCE-HKUYNNGSSA-N |
| XLogP | 2.69 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |