C25H34N4O — CID 71235656
1-[(1R,2R)-2-[(1-benzylpiperidin-3-yl)amino]cyclohexyl]-3-phenylurea (PubChem CID 71235656) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-[(1R,2R)-2-[(1-benzylpiperidin-3-yl)amino]cyclohexyl]-3-phenylurea.
| Compound Name | 1-[(1R,2R)-2-[(1-benzylpiperidin-3-yl)amino]cyclohexyl]-3-phenylurea |
|---|---|
| PubChem CID | 71235656 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-[(1R,2R)-2-[(1-benzylpiperidin-3-yl)amino]cyclohexyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@@H]1CCCC[C@H]1NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H34N4O/c30-25(27-21-12-5-2-6-13-21)28-24-16-8-7-15-23(24)26-22-14-9-17-29(19-22)18-20-10-3-1-4-11-20/h1-6,10-13,22-24,26H,7-9,14-19H2,(H2,27,28,30)/t22?,23-,24-/m1/s1 |
| InChIKey | QWUWCQVNVZRYRE-HEYJASKDSA-N |
| XLogP | 4.37 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |