C17H21FN4O2 — CID 98776906
2,5-dihydropyrrol-1-yl-[(4R)-2-(5-fluoropyrimidin-2-yl)-8-oxa-2-azaspiro[4.5]decan-4-yl]methanone (PubChem CID 98776906) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is 2,5-dihydropyrrol-1-yl-[(4R)-2-(5-fluoropyrimidin-2-yl)-8-oxa-2-azaspiro[4.5]decan-4-yl]methanone.
| Compound Name | 2,5-dihydropyrrol-1-yl-[(4R)-2-(5-fluoropyrimidin-2-yl)-8-oxa-2-azaspiro[4.5]decan-4-yl]methanone |
|---|---|
| PubChem CID | 98776906 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2,5-dihydropyrrol-1-yl-[(4R)-2-(5-fluoropyrimidin-2-yl)-8-oxa-2-azaspiro[4.5]decan-4-yl]methanone |
| SMILES | O=C([C@H]1CN(c2ncc(F)cn2)CC12CCOCC2)N1CC=CC1 |
| InChI | InChI=1S/C17H21FN4O2/c18-13-9-19-16(20-10-13)22-11-14(15(23)21-5-1-2-6-21)17(12-22)3-7-24-8-4-17/h1-2,9-10,14H,3-8,11-12H2/t14-/m1/s1 |
| InChIKey | FZOXCOPWEYXDOA-CQSZACIVSA-N |
| XLogP | 1.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|