C19H23FN2O3 — CID 98777413
1-[(3R,3aS,7aR)-1-[2-(4-fluorophenyl)acetyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]pyrrolidin-2-one (PubChem CID 98777413) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[(3R,3aS,7aR)-1-[2-(4-fluorophenyl)acetyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3R,3aS,7aR)-1-[2-(4-fluorophenyl)acetyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 98777413 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[(3R,3aS,7aR)-1-[2-(4-fluorophenyl)acetyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1[C@@H]1CN(C(=O)Cc2ccc(F)cc2)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C19H23FN2O3/c20-14-7-5-13(6-8-14)11-18(24)22-12-16(21-9-1-4-17(21)23)19-15(22)3-2-10-25-19/h5-8,15-16,19H,1-4,9-12H2/t15-,16-,19+/m1/s1 |
| InChIKey | NPINTQBXVDQBLW-MDZRGWNJSA-N |
| XLogP | 1.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |