C15H18F2N2O4S — CID 98778729
(3aS,6aS)-1-(3,5-difluorophenyl)sulfonyl-4-(2-methoxyethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 98778729) has the molecular formula C15H18F2N2O4S and a molecular weight of 360.38 g/mol. Its IUPAC name is (3aS,6aS)-1-(3,5-difluorophenyl)sulfonyl-4-(2-methoxyethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aS)-1-(3,5-difluorophenyl)sulfonyl-4-(2-methoxyethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 98778729 |
| Molecular Formula | C15H18F2N2O4S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (3aS,6aS)-1-(3,5-difluorophenyl)sulfonyl-4-(2-methoxyethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | COCCN1C(=O)C[C@H]2[C@@H]1CCN2S(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H18F2N2O4S/c1-23-5-4-18-13-2-3-19(14(13)9-15(18)20)24(21,22)12-7-10(16)6-11(17)8-12/h6-8,13-14H,2-5,9H2,1H3/t13-,14-/m0/s1 |
| InChIKey | NKBPDPCYIFIJFR-KBPBESRZSA-N |
| XLogP | 0.98 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |