C20H25ClN2O3 — CID 98785710
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 98785710) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 98785710 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](NC(=O)CN1C(=O)COc3ccc(Cl)cc31)C2 |
| InChI | InChI=1S/C20H25ClN2O3/c1-19(2)12-6-7-20(19,3)16(8-12)22-17(24)10-23-14-9-13(21)4-5-15(14)26-11-18(23)25/h4-5,9,12,16H,6-8,10-11H2,1-3H3,(H,22,24)/t12-,16-,20-/m0/s1 |
| InChIKey | CWZTXZBWUIKDOF-APXLUKDGSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |