C19H24N2O4S — CID 98786378
N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-ethyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxamide (PubChem CID 98786378) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-ethyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxamide.
| Compound Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-ethyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 98786378 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-ethyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxamide |
| SMILES | CCN1C(=O)c2ccc(C(=O)NCC[C@@H]3C[C@H]4CC[C@H]3C4)cc2S1(=O)=O |
| InChI | InChI=1S/C19H24N2O4S/c1-2-21-19(23)16-6-5-15(11-17(16)26(21,24)25)18(22)20-8-7-14-10-12-3-4-13(14)9-12/h5-6,11-14H,2-4,7-10H2,1H3,(H,20,22)/t12-,13-,14+/m0/s1 |
| InChIKey | YHOQFOASNBQIKZ-MELADBBJSA-N |
| XLogP | 2.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |