C18H29N5O — CID 98792505
1-[2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-3-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]urea (PubChem CID 98792505) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-3-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]urea.
| Compound Name | 1-[2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-3-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]urea |
|---|---|
| PubChem CID | 98792505 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 1-[2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-3-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]urea |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](NC(=O)NCCc1nnc3n1CCC3)C2 |
| InChI | InChI=1S/C18H29N5O/c1-17(2)12-6-8-18(17,3)13(11-12)20-16(24)19-9-7-15-22-21-14-5-4-10-23(14)15/h12-13H,4-11H2,1-3H3,(H2,19,20,24)/t12-,13-,18-/m0/s1 |
| InChIKey | ZTISBNVOOVQOFO-LXIYXOSZSA-N |
| XLogP | 2.28 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |