C14H23N3O4 — CID 98798751
(4R)-2-oxo-N,N-bis[[(2S)-oxolan-2-yl]methyl]imidazolidine-4-carboxamide (PubChem CID 98798751) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is (4R)-2-oxo-N,N-bis[[(2S)-oxolan-2-yl]methyl]imidazolidine-4-carboxamide.
| Compound Name | (4R)-2-oxo-N,N-bis[[(2S)-oxolan-2-yl]methyl]imidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 98798751 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (4R)-2-oxo-N,N-bis[[(2S)-oxolan-2-yl]methyl]imidazolidine-4-carboxamide |
| SMILES | O=C1NC[C@H](C(=O)N(C[C@@H]2CCCO2)C[C@@H]2CCCO2)N1 |
| InChI | InChI=1S/C14H23N3O4/c18-13(12-7-15-14(19)16-12)17(8-10-3-1-5-20-10)9-11-4-2-6-21-11/h10-12H,1-9H2,(H2,15,16,19)/t10-,11-,12+/m0/s1 |
| InChIKey | JHTHVELLGSKJTH-SDDRHHMPSA-N |
| XLogP | -0.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |