C15H19FN4O3 — CID 98810396
[(3aR,7S,7aR)-2-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 98810396) has the molecular formula C15H19FN4O3 and a molecular weight of 322.34 g/mol. Its IUPAC name is [(3aR,7S,7aR)-2-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(3aR,7S,7aR)-2-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 98810396 |
| Molecular Formula | C15H19FN4O3 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [(3aR,7S,7aR)-2-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | O=C([C@@H]1COC[C@H]2CN(c3ncc(F)cn3)C[C@H]21)N1CCCO1 |
| InChI | InChI=1S/C15H19FN4O3/c16-11-4-17-15(18-5-11)19-6-10-8-22-9-13(12(10)7-19)14(21)20-2-1-3-23-20/h4-5,10,12-13H,1-3,6-9H2/t10-,12-,13-/m1/s1 |
| InChIKey | AMJVFEOULOLWJI-RAIGVLPGSA-N |
| XLogP | 0.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |