C20H31NO3 — CID 98816463
(4aS,8aS)-4a-(cyclopentylmethoxymethyl)-6-(furan-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 98816463) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (4aS,8aS)-4a-(cyclopentylmethoxymethyl)-6-(furan-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | (4aS,8aS)-4a-(cyclopentylmethoxymethyl)-6-(furan-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 98816463 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | (4aS,8aS)-4a-(cyclopentylmethoxymethyl)-6-(furan-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | c1cc(CN2CC[C@@H]3OCCC[C@@]3(COCC3CCCC3)C2)co1 |
| InChI | InChI=1S/C20H31NO3/c1-2-5-17(4-1)13-23-16-20-8-3-10-24-19(20)6-9-21(15-20)12-18-7-11-22-14-18/h7,11,14,17,19H,1-6,8-10,12-13,15-16H2/t19-,20-/m0/s1 |
| InChIKey | ZPCCGJGMBOWHNR-PMACEKPBSA-N |
| XLogP | 3.86 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |