C19H30N2O4 — CID 98845527
N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(1,4-dioxaspiro[4.5]decan-8-ylideneamino)oxyacetamide (PubChem CID 98845527) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(1,4-dioxaspiro[4.5]decan-8-ylideneamino)oxyacetamide.
| Compound Name | N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(1,4-dioxaspiro[4.5]decan-8-ylideneamino)oxyacetamide |
|---|---|
| PubChem CID | 98845527 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(1,4-dioxaspiro[4.5]decan-8-ylideneamino)oxyacetamide |
| SMILES | C[C@@H](NC(=O)CON=C1CCC2(CC1)OCCO2)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C19H30N2O4/c1-13(17-11-14-2-3-15(17)10-14)20-18(22)12-25-21-16-4-6-19(7-5-16)23-8-9-24-19/h13-15,17H,2-12H2,1H3,(H,20,22)/t13-,14+,15+,17+/m1/s1 |
| InChIKey | QQKRUEYSXFGKKG-AESZEHBQSA-N |
| XLogP | 2.62 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|