C15H14ClNO2 — CID 98846999
(1E,2S)-N-hydroxy-2-(3-methoxyphenyl)-2-phenylethanimidoyl chloride (PubChem CID 98846999) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is (1E,2S)-N-hydroxy-2-(3-methoxyphenyl)-2-phenylethanimidoyl chloride.
| Compound Name | (1E,2S)-N-hydroxy-2-(3-methoxyphenyl)-2-phenylethanimidoyl chloride |
|---|---|
| PubChem CID | 98846999 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (1E,2S)-N-hydroxy-2-(3-methoxyphenyl)-2-phenylethanimidoyl chloride |
| SMILES | COc1cccc([C@@H](/C(Cl)=N\O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H14ClNO2/c1-19-13-9-5-8-12(10-13)14(15(16)17-18)11-6-3-2-4-7-11/h2-10,14,18H,1H3/b17-15+/t14-/m0/s1 |
| InChIKey | LAKHZIYZYGYFFX-AQTLKONXSA-N |
| XLogP | 3.85 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|