C20H35N3O2 — CID 98848765
(3aS,7aS)-N-[(3R,4S)-3-methyl-1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 98848765) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is (3aS,7aS)-N-[(3R,4S)-3-methyl-1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aS,7aS)-N-[(3R,4S)-3-methyl-1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 98848765 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | (3aS,7aS)-N-[(3R,4S)-3-methyl-1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | C[C@@H]1CN(C[C@@H]2CCCO2)CC[C@@H]1NC(=O)N1C[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C20H35N3O2/c1-15-11-22(14-18-7-4-10-25-18)9-8-19(15)21-20(24)23-12-16-5-2-3-6-17(16)13-23/h15-19H,2-14H2,1H3,(H,21,24)/t15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | SKXNBDYWCGYTKX-QQXKLLMISA-N |
| XLogP | 2.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |