C19H30N4O2 — CID 97241045
(E)-3-(2-ethylpyrazol-3-yl)-N-[(3S,4R)-3-methyl-1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]prop-2-enamide (PubChem CID 97241045) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is (E)-3-(2-ethylpyrazol-3-yl)-N-[(3S,4R)-3-methyl-1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-ethylpyrazol-3-yl)-N-[(3S,4R)-3-methyl-1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 97241045 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (E)-3-(2-ethylpyrazol-3-yl)-N-[(3S,4R)-3-methyl-1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]prop-2-enamide |
| SMILES | CCn1nccc1/C=C/C(=O)N[C@@H]1CCN(C[C@@H]2CCCO2)C[C@@H]1C |
| InChI | InChI=1S/C19H30N4O2/c1-3-23-16(8-10-20-23)6-7-19(24)21-18-9-11-22(13-15(18)2)14-17-5-4-12-25-17/h6-8,10,15,17-18H,3-5,9,11-14H2,1-2H3,(H,21,24)/b7-6+/t15-,17-,18+/m0/s1 |
| InChIKey | DJFCRFFWDDSKIX-WXQDYTQUSA-N |
| XLogP | 1.92 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|