C15H24N2O3S — CID 98852376
3-[(1S)-1-[[[(1R)-1-cyclopropylethyl]-methylsulfamoyl]-methylamino]ethyl]phenol (PubChem CID 98852376) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-[(1S)-1-[[[(1R)-1-cyclopropylethyl]-methylsulfamoyl]-methylamino]ethyl]phenol.
| Compound Name | 3-[(1S)-1-[[[(1R)-1-cyclopropylethyl]-methylsulfamoyl]-methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 98852376 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-[(1S)-1-[[[(1R)-1-cyclopropylethyl]-methylsulfamoyl]-methylamino]ethyl]phenol |
| SMILES | C[C@H](C1CC1)N(C)S(=O)(=O)N(C)[C@@H](C)c1cccc(O)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-11(13-8-9-13)16(3)21(19,20)17(4)12(2)14-6-5-7-15(18)10-14/h5-7,10-13,18H,8-9H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | ISTVZIAULBDUDM-NEPJUHHUSA-N |
| XLogP | 2.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |