About N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide
N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide (PubChem CID 98853448) has the molecular formula C15H20F2N2OS
and a molecular weight of 314.40 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide.
Molecular Properties
| Compound Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide |
| PubChem CID | 98853448 |
| Molecular Formula | C15H20F2N2OS |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide |
| SMILES | C[C@H](NC(=O)CN(C)[C@H]1CCSC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F2N2OS/c1-10(13-4-3-11(16)7-14(13)17)18-15(20)8-19(2)12-5-6-21-9-12/h3-4,7,10,12H,5-6,8-9H2,1-2H3,(H,18,20)/t10-,12-/m0/s1 |
| InChIKey | MGUBZYPGQFTAKL-JQWIXIFHSA-N |
| XLogP | 2.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide?
The IUPAC name of N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide (CID 98853448) is N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide.
What is the SMILES notation for N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide?
The canonical SMILES for N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide is C[C@H](NC(=O)CN(C)[C@H]1CCSC1)c1ccc(F)cc1F.
What is the InChIKey of N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide?
The InChIKey is MGUBZYPGQFTAKL-JQWIXIFHSA-N. The full InChI is InChI=1S/C15H20F2N2OS/c1-10(13-4-3-11(16)7-14(13)17)18-15(20)8-19(2)12-5-6-21-9-12/h3-4,7,10,12H,5-6,8-9H2,1-2H3,(H,18,20)/t10-,12-/m0/s1.
What are the key properties of N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide?
N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide has a molecular weight of 314.40 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-[methyl-[(3S)-thiolan-3-yl]amino]acetamide is sourced from PubChem (CID 98853448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).