C14H19ClFN3O2 — CID 98854487
1-[[(2S,3S)-2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methyl]-3-methoxyurea (PubChem CID 98854487) has the molecular formula C14H19ClFN3O2 and a molecular weight of 315.78 g/mol. Its IUPAC name is 1-[[(2S,3S)-2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methyl]-3-methoxyurea.
| Compound Name | 1-[[(2S,3S)-2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methyl]-3-methoxyurea |
|---|---|
| PubChem CID | 98854487 |
| Molecular Formula | C14H19ClFN3O2 |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-[[(2S,3S)-2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methyl]-3-methoxyurea |
| SMILES | CONC(=O)NC[C@@H]1CCN(C)[C@@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H19ClFN3O2/c1-19-6-5-10(8-17-14(20)18-21-2)13(19)9-3-4-11(15)12(16)7-9/h3-4,7,10,13H,5-6,8H2,1-2H3,(H2,17,18,20)/t10-,13+/m0/s1 |
| InChIKey | XMVQSWQSUBKVTH-GXFFZTMASA-N |
| XLogP | 2.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|