C18H18N4O2 — CID 98857312
4-[[(3R,4S)-1-methyl-4-phenylpyrrolidin-3-yl]amino]-3-nitrobenzonitrile (PubChem CID 98857312) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-[[(3R,4S)-1-methyl-4-phenylpyrrolidin-3-yl]amino]-3-nitrobenzonitrile.
| Compound Name | 4-[[(3R,4S)-1-methyl-4-phenylpyrrolidin-3-yl]amino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 98857312 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-[[(3R,4S)-1-methyl-4-phenylpyrrolidin-3-yl]amino]-3-nitrobenzonitrile |
| SMILES | CN1C[C@H](Nc2ccc(C#N)cc2[N+](=O)[O-])[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H18N4O2/c1-21-11-15(14-5-3-2-4-6-14)17(12-21)20-16-8-7-13(10-19)9-18(16)22(23)24/h2-9,15,17,20H,11-12H2,1H3/t15-,17+/m1/s1 |
| InChIKey | MFPUIRHQZITFOL-WBVHZDCISA-N |
| XLogP | 2.98 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|