About (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one
(5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one (PubChem CID 98869775) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one.
Molecular Properties
| Compound Name | (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one |
| PubChem CID | 98869775 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one |
| SMILES | O=C1CC[C@H](N[C@H]2CCC[C@@H]2Cc2ccccc2)CN1 |
| InChI | InChI=1S/C17H24N2O/c20-17-10-9-15(12-18-17)19-16-8-4-7-14(16)11-13-5-2-1-3-6-13/h1-3,5-6,14-16,19H,4,7-12H2,(H,18,20)/t14-,15+,16+/m1/s1 |
| InChIKey | DAWWRANUBFSKMK-PMPSAXMXSA-N |
| XLogP | 2.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one?
The IUPAC name of (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one (CID 98869775) is (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one.
What is the SMILES notation for (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one?
The canonical SMILES for (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one is O=C1CC[C@H](N[C@H]2CCC[C@@H]2Cc2ccccc2)CN1.
What is the InChIKey of (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one?
The InChIKey is DAWWRANUBFSKMK-PMPSAXMXSA-N. The full InChI is InChI=1S/C17H24N2O/c20-17-10-9-15(12-18-17)19-16-8-4-7-14(16)11-13-5-2-1-3-6-13/h1-3,5-6,14-16,19H,4,7-12H2,(H,18,20)/t14-,15+,16+/m1/s1.
What are the key properties of (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one?
(5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one has a molecular weight of 272.39 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[[(1S,2R)-2-benzylcyclopentyl]amino]piperidin-2-one is sourced from PubChem (CID 98869775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).