C25H23N3O4 — CID 98871805
(E)-N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 98871805) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is (E)-N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 98871805 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (E)-N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCN(C(=O)Cc1ccc(NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O4/c1-2-27(22-6-4-3-5-7-22)25(30)18-20-8-13-21(14-9-20)26-24(29)17-12-19-10-15-23(16-11-19)28(31)32/h3-17H,2,18H2,1H3,(H,26,29)/b17-12+ |
| InChIKey | LZIZWCFKFWBJJD-SFQUDFHCSA-N |
| XLogP | 4.84 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|