About (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol
(1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol (PubChem CID 98878106) has the molecular formula C16H29N3O3S
and a molecular weight of 343.49 g/mol. Its IUPAC name is (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol |
| PubChem CID | 98878106 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol |
| SMILES | Cc1nn(CC(C)C)c(C)c1S(=O)(=O)N1CCC[C@@H]([C@H](C)O)C1 |
| InChI | InChI=1S/C16H29N3O3S/c1-11(2)9-19-13(4)16(12(3)17-19)23(21,22)18-8-6-7-15(10-18)14(5)20/h11,14-15,20H,6-10H2,1-5H3/t14-,15+/m0/s1 |
| InChIKey | VXAFVLWHLPKCQI-LSDHHAIUSA-N |
| XLogP | 1.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol?
The IUPAC name of (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol (CID 98878106) is (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol.
What is the SMILES notation for (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol?
The canonical SMILES for (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol is Cc1nn(CC(C)C)c(C)c1S(=O)(=O)N1CCC[C@@H]([C@H](C)O)C1.
What is the InChIKey of (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol?
The InChIKey is VXAFVLWHLPKCQI-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H29N3O3S/c1-11(2)9-19-13(4)16(12(3)17-19)23(21,22)18-8-6-7-15(10-18)14(5)20/h11,14-15,20H,6-10H2,1-5H3/t14-,15+/m0/s1.
What are the key properties of (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol?
(1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol has a molecular weight of 343.49 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(3R)-1-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonylpiperidin-3-yl]ethanol is sourced from PubChem (CID 98878106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).