C18H24N2O3 — CID 98888201
methyl (3aS,6aS)-2-[(2-acetamidophenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate (PubChem CID 98888201) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl (3aS,6aS)-2-[(2-acetamidophenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,6aS)-2-[(2-acetamidophenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 98888201 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | methyl (3aS,6aS)-2-[(2-acetamidophenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CCC[C@@H]1CN(Cc1ccccc1NC(C)=O)C2 |
| InChI | InChI=1S/C18H24N2O3/c1-13(21)19-16-8-4-3-6-14(16)10-20-11-15-7-5-9-18(15,12-20)17(22)23-2/h3-4,6,8,15H,5,7,9-12H2,1-2H3,(H,19,21)/t15-,18-/m1/s1 |
| InChIKey | XRQHUJURCNKUSC-CRAIPNDOSA-N |
| XLogP | 2.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |