C19H26N2O3 — CID 98889561
1-[[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]urea (PubChem CID 98889561) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]urea.
| Compound Name | 1-[[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]urea |
|---|---|
| PubChem CID | 98889561 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]urea |
| SMILES | COc1ccc2c(c1)CCC[C@H]2CNC(=O)N[C@H]1C[C@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C19H26N2O3/c1-23-14-5-7-16-12(9-14)3-2-4-13(16)11-20-19(22)21-17-10-15-6-8-18(17)24-15/h5,7,9,13,15,17-18H,2-4,6,8,10-11H2,1H3,(H2,20,21,22)/t13-,15+,17-,18+/m0/s1 |
| InChIKey | GIGLCIDCWMVXGQ-UNQWWWNPSA-N |
| XLogP | 2.73 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |